C8H6F5N7O — CID 80871032
4-(2,2,3,3,3-pentafluoropropoxy)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 80871032) has the molecular formula C8H6F5N7O and a molecular weight of 311.17 g/mol. Its IUPAC name is 4-(2,2,3,3,3-pentafluoropropoxy)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,2,3,3,3-pentafluoropropoxy)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80871032 |
| Molecular Formula | C8H6F5N7O |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 4-(2,2,3,3,3-pentafluoropropoxy)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(OCC(F)(F)C(F)(F)F)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C8H6F5N7O/c9-7(10,8(11,12)13)1-21-6-18-4(14)17-5(19-6)20-3-15-2-16-20/h2-3H,1H2,(H2,14,17,18,19) |
| InChIKey | GTXHKZUUWZWYAS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|