C9H11N7O — CID 80861454
4-but-3-enoxy-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 80861454) has the molecular formula C9H11N7O and a molecular weight of 233.23 g/mol. Its IUPAC name is 4-but-3-enoxy-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-but-3-enoxy-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80861454 |
| Molecular Formula | C9H11N7O |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 4-but-3-enoxy-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | C=CCCOc1nc(N)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C9H11N7O/c1-2-3-4-17-9-14-7(10)13-8(15-9)16-6-11-5-12-16/h2,5-6H,1,3-4H2,(H2,10,13,14,15) |
| InChIKey | XYNCIAFSIBWIGL-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|