C10H16N4O2 — CID 80861844
4-but-3-enoxy-6-propan-2-yloxy-1,3,5-triazin-2-amine (PubChem CID 80861844) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 4-but-3-enoxy-6-propan-2-yloxy-1,3,5-triazin-2-amine.
| Compound Name | 4-but-3-enoxy-6-propan-2-yloxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80861844 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 4-but-3-enoxy-6-propan-2-yloxy-1,3,5-triazin-2-amine |
| SMILES | C=CCCOc1nc(N)nc(OC(C)C)n1 |
| InChI | InChI=1S/C10H16N4O2/c1-4-5-6-15-9-12-8(11)13-10(14-9)16-7(2)3/h4,7H,1,5-6H2,2-3H3,(H2,11,12,13,14) |
| InChIKey | XBJLWVCAJUXFPB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|