C10H15F3N4O2 — CID 82795407
4-propan-2-yloxy-6-(4,4,4-trifluorobutoxy)-1,3,5-triazin-2-amine (PubChem CID 82795407) has the molecular formula C10H15F3N4O2 and a molecular weight of 280.25 g/mol. Its IUPAC name is 4-propan-2-yloxy-6-(4,4,4-trifluorobutoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-propan-2-yloxy-6-(4,4,4-trifluorobutoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 82795407 |
| Molecular Formula | C10H15F3N4O2 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-propan-2-yloxy-6-(4,4,4-trifluorobutoxy)-1,3,5-triazin-2-amine |
| SMILES | CC(C)Oc1nc(N)nc(OCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H15F3N4O2/c1-6(2)19-9-16-7(14)15-8(17-9)18-5-3-4-10(11,12)13/h6H,3-5H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | DJKIAWOLYXJYQC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|