C10H13ClN6O2 — CID 63685456
2-chloro-4-(2-propoxyethoxy)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine (PubChem CID 63685456) has the molecular formula C10H13ClN6O2 and a molecular weight of 284.71 g/mol. Its IUPAC name is 2-chloro-4-(2-propoxyethoxy)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-(2-propoxyethoxy)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 63685456 |
| Molecular Formula | C10H13ClN6O2 |
| Molecular Weight | 284.71 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-chloro-4-(2-propoxyethoxy)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine |
| SMILES | CCCOCCOc1nc(Cl)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C10H13ClN6O2/c1-2-3-18-4-5-19-10-15-8(11)14-9(16-10)17-7-12-6-13-17/h6-7H,2-5H2,1H3 |
| InChIKey | KAEIHJCPDRMKFB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 87.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.71 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|