C12H19N7O — CID 80861914
4-hexoxy-N-methyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 80861914) has the molecular formula C12H19N7O and a molecular weight of 277.33 g/mol. Its IUPAC name is 4-hexoxy-N-methyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-hexoxy-N-methyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80861914 |
| Molecular Formula | C12H19N7O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 4-hexoxy-N-methyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CCCCCCOc1nc(NC)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C12H19N7O/c1-3-4-5-6-7-20-12-17-10(13-2)16-11(18-12)19-9-14-8-15-19/h8-9H,3-7H2,1-2H3,(H,13,16,17,18) |
| InChIKey | IRTGMCZNVSXITP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|