C10H13N7O — CID 80873486
4-[(E)-but-2-enoxy]-N-methyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 80873486) has the molecular formula C10H13N7O and a molecular weight of 247.26 g/mol. Its IUPAC name is 4-[(E)-but-2-enoxy]-N-methyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-[(E)-but-2-enoxy]-N-methyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80873486 |
| Molecular Formula | C10H13N7O |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4-[(E)-but-2-enoxy]-N-methyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | C/C=C/COc1nc(NC)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C10H13N7O/c1-3-4-5-18-10-15-8(11-2)14-9(16-10)17-7-12-6-13-17/h3-4,6-7H,5H2,1-2H3,(H,11,14,15,16)/b4-3+ |
| InChIKey | UGJOEVSIHMFALU-ONEGZZNKSA-N |
| XLogP | 0.45 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|