C9H10F3N7O — CID 80877877
N-methyl-4-(1,2,4-triazol-1-yl)-6-(1,1,1-trifluoropropan-2-yloxy)-1,3,5-triazin-2-amine (PubChem CID 80877877) has the molecular formula C9H10F3N7O and a molecular weight of 289.22 g/mol. Its IUPAC name is N-methyl-4-(1,2,4-triazol-1-yl)-6-(1,1,1-trifluoropropan-2-yloxy)-1,3,5-triazin-2-amine.
| Compound Name | N-methyl-4-(1,2,4-triazol-1-yl)-6-(1,1,1-trifluoropropan-2-yloxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80877877 |
| Molecular Formula | C9H10F3N7O |
| Molecular Weight | 289.22 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-methyl-4-(1,2,4-triazol-1-yl)-6-(1,1,1-trifluoropropan-2-yloxy)-1,3,5-triazin-2-amine |
| SMILES | CNc1nc(OC(C)C(F)(F)F)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C9H10F3N7O/c1-5(9(10,11)12)20-8-17-6(13-2)16-7(18-8)19-4-14-3-15-19/h3-5H,1-2H3,(H,13,16,17,18) |
| InChIKey | PPNDIQFBKNVDMV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |