C11H18N8O — CID 80809298
4-N-(1-methoxypropan-2-yl)-2-N,4-N-dimethyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 80809298) has the molecular formula C11H18N8O and a molecular weight of 278.32 g/mol. Its IUPAC name is 4-N-(1-methoxypropan-2-yl)-2-N,4-N-dimethyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(1-methoxypropan-2-yl)-2-N,4-N-dimethyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80809298 |
| Molecular Formula | C11H18N8O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 4-N-(1-methoxypropan-2-yl)-2-N,4-N-dimethyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(N(C)C(C)COC)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C11H18N8O/c1-8(5-20-4)18(3)10-15-9(12-2)16-11(17-10)19-7-13-6-14-19/h6-8H,5H2,1-4H3,(H,12,15,16,17) |
| InChIKey | LLASPLZGRHLYJS-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |