C12H20N8O — CID 81064836
2-N,4-N-dimethyl-4-N-(2-propan-2-yloxyethyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 81064836) has the molecular formula C12H20N8O and a molecular weight of 292.35 g/mol. Its IUPAC name is 2-N,4-N-dimethyl-4-N-(2-propan-2-yloxyethyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-dimethyl-4-N-(2-propan-2-yloxyethyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 81064836 |
| Molecular Formula | C12H20N8O |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2-N,4-N-dimethyl-4-N-(2-propan-2-yloxyethyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(N(C)CCOC(C)C)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C12H20N8O/c1-9(2)21-6-5-19(4)11-16-10(13-3)17-12(18-11)20-8-14-7-15-20/h7-9H,5-6H2,1-4H3,(H,13,16,17,18) |
| InChIKey | CTGKAYXTXVMCKS-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |