C10H13F5N4O2 — CID 80871130
N-methyl-4-(2,2,3,3,3-pentafluoropropoxy)-6-propoxy-1,3,5-triazin-2-amine (PubChem CID 80871130) has the molecular formula C10H13F5N4O2 and a molecular weight of 316.23 g/mol. Its IUPAC name is N-methyl-4-(2,2,3,3,3-pentafluoropropoxy)-6-propoxy-1,3,5-triazin-2-amine.
| Compound Name | N-methyl-4-(2,2,3,3,3-pentafluoropropoxy)-6-propoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80871130 |
| Molecular Formula | C10H13F5N4O2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-methyl-4-(2,2,3,3,3-pentafluoropropoxy)-6-propoxy-1,3,5-triazin-2-amine |
| SMILES | CCCOc1nc(NC)nc(OCC(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F5N4O2/c1-3-4-20-7-17-6(16-2)18-8(19-7)21-5-9(11,12)10(13,14)15/h3-5H2,1-2H3,(H,16,17,18,19) |
| InChIKey | ZZTDCPJTNUSAJY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|