C10H14N6O2 — CID 80865388
4-(3-methoxypropoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-amine (PubChem CID 80865388) has the molecular formula C10H14N6O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 4-(3-methoxypropoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(3-methoxypropoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80865388 |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 4-(3-methoxypropoxy)-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
| SMILES | COCCCOc1nc(N)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C10H14N6O2/c1-17-6-3-7-18-10-14-8(11)13-9(15-10)16-5-2-4-12-16/h2,4-5H,3,6-7H2,1H3,(H2,11,13,14,15) |
| InChIKey | BBCMKDNPQYTAKA-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|