C13H20N6O — CID 80862326
4-heptoxy-6-pyrazol-1-yl-1,3,5-triazin-2-amine (PubChem CID 80862326) has the molecular formula C13H20N6O and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-heptoxy-6-pyrazol-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-heptoxy-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80862326 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 4-heptoxy-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
| SMILES | CCCCCCCOc1nc(N)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C13H20N6O/c1-2-3-4-5-6-10-20-13-17-11(14)16-12(18-13)19-9-7-8-15-19/h7-9H,2-6,10H2,1H3,(H2,14,16,17,18) |
| InChIKey | MUPJIIORGOCZKY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|