C9H12F3N9 — CID 80900792
N-ethyl-4-hydrazinyl-6-(1,2,4-triazol-1-yl)-N-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine (PubChem CID 80900792) has the molecular formula C9H12F3N9 and a molecular weight of 303.25 g/mol. Its IUPAC name is N-ethyl-4-hydrazinyl-6-(1,2,4-triazol-1-yl)-N-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine.
| Compound Name | N-ethyl-4-hydrazinyl-6-(1,2,4-triazol-1-yl)-N-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80900792 |
| Molecular Formula | C9H12F3N9 |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-ethyl-4-hydrazinyl-6-(1,2,4-triazol-1-yl)-N-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine |
| SMILES | CCN(CC(F)(F)F)c1nc(NN)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C9H12F3N9/c1-2-20(3-9(10,11)12)7-16-6(19-13)17-8(18-7)21-5-14-4-15-21/h4-5H,2-3,13H2,1H3,(H,16,17,18,19) |
| InChIKey | ACTUMNWOJWNKLM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|