C11H16N10 — CID 80900254
3-[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]-propan-2-ylamino]propanenitrile (PubChem CID 80900254) has the molecular formula C11H16N10 and a molecular weight of 288.32 g/mol. Its IUPAC name is 3-[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]-propan-2-ylamino]propanenitrile.
| Compound Name | 3-[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]-propan-2-ylamino]propanenitrile |
|---|---|
| PubChem CID | 80900254 |
| Molecular Formula | C11H16N10 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 3-[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]-propan-2-ylamino]propanenitrile |
| SMILES | CC(C)N(CCC#N)c1nc(NN)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C11H16N10/c1-8(2)20(5-3-4-12)10-16-9(19-13)17-11(18-10)21-7-14-6-15-21/h6-8H,3,5,13H2,1-2H3,(H,16,17,18,19) |
| InChIKey | IQCCZAYMLJYPEB-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|