C10H17N9O — CID 80922653
1-[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]-methylamino]-2-methylpropan-2-ol (PubChem CID 80922653) has the molecular formula C10H17N9O and a molecular weight of 279.31 g/mol. Its IUPAC name is 1-[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]-methylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]-methylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 80922653 |
| Molecular Formula | C10H17N9O |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 1-[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]-methylamino]-2-methylpropan-2-ol |
| SMILES | CN(CC(C)(C)O)c1nc(NN)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C10H17N9O/c1-10(2,20)4-18(3)8-14-7(17-11)15-9(16-8)19-6-12-5-13-19/h5-6,20H,4,11H2,1-3H3,(H,14,15,16,17) |
| InChIKey | GPVOEPFPWFJAEK-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|