C10H12N8O — CID 113461427
[4-(2-methylbut-3-yn-2-yloxy)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine (PubChem CID 113461427) has the molecular formula C10H12N8O and a molecular weight of 260.26 g/mol. Its IUPAC name is [4-(2-methylbut-3-yn-2-yloxy)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(2-methylbut-3-yn-2-yloxy)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 113461427 |
| Molecular Formula | C10H12N8O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | [4-(2-methylbut-3-yn-2-yloxy)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine |
| SMILES | C#CC(C)(C)Oc1nc(NN)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C10H12N8O/c1-4-10(2,3)19-9-15-7(17-11)14-8(16-9)18-6-12-5-13-18/h1,5-6H,11H2,2-3H3,(H,14,15,16,17) |
| InChIKey | CAYOLRBIULXTIZ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|