C9H12N8O2S — CID 80923175
methyl 3-[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]sulfanyl]propanoate (PubChem CID 80923175) has the molecular formula C9H12N8O2S and a molecular weight of 296.32 g/mol. Its IUPAC name is methyl 3-[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]sulfanyl]propanoate.
| Compound Name | methyl 3-[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 80923175 |
| Molecular Formula | C9H12N8O2S |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | methyl 3-[[4-hydrazinyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]sulfanyl]propanoate |
| SMILES | COC(=O)CCSc1nc(NN)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C9H12N8O2S/c1-19-6(18)2-3-20-9-14-7(16-10)13-8(15-9)17-5-11-4-12-17/h4-5H,2-3,10H2,1H3,(H,13,14,15,16) |
| InChIKey | XKJBDMZJGABSAV-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|