C9H10N10S2 — CID 80929997
[4-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80929997) has the molecular formula C9H10N10S2 and a molecular weight of 322.38 g/mol. Its IUPAC name is [4-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80929997 |
| Molecular Formula | C9H10N10S2 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | [4-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CCc1nsc(Sc2nc(NN)nc(-n3cncn3)n2)n1 |
| InChI | InChI=1S/C9H10N10S2/c1-2-5-13-9(21-18-5)20-8-15-6(17-10)14-7(16-8)19-4-11-3-12-19/h3-4H,2,10H2,1H3,(H,14,15,16,17) |
| InChIKey | MMMXJYMNZDEPGS-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 133.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|