C12H12N8S — CID 80925315
[4-(4-methylphenyl)sulfanyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80925315) has the molecular formula C12H12N8S and a molecular weight of 300.35 g/mol. Its IUPAC name is [4-(4-methylphenyl)sulfanyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(4-methylphenyl)sulfanyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80925315 |
| Molecular Formula | C12H12N8S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | [4-(4-methylphenyl)sulfanyl-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]hydrazine |
| SMILES | Cc1ccc(Sc2nc(NN)nc(-n3cncn3)n2)cc1 |
| InChI | InChI=1S/C12H12N8S/c1-8-2-4-9(5-3-8)21-12-17-10(19-13)16-11(18-12)20-7-14-6-15-20/h2-7H,13H2,1H3,(H,16,17,18,19) |
| InChIKey | IYGIQNLUIGRPAI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|