C10H13F3N8 — CID 80900789
N-ethyl-4-hydrazinyl-6-pyrazol-1-yl-N-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine (PubChem CID 80900789) has the molecular formula C10H13F3N8 and a molecular weight of 302.26 g/mol. Its IUPAC name is N-ethyl-4-hydrazinyl-6-pyrazol-1-yl-N-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine.
| Compound Name | N-ethyl-4-hydrazinyl-6-pyrazol-1-yl-N-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80900789 |
| Molecular Formula | C10H13F3N8 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-ethyl-4-hydrazinyl-6-pyrazol-1-yl-N-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine |
| SMILES | CCN(CC(F)(F)F)c1nc(NN)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C10H13F3N8/c1-2-20(6-10(11,12)13)8-16-7(19-14)17-9(18-8)21-5-3-4-15-21/h3-5H,2,6,14H2,1H3,(H,16,17,18,19) |
| InChIKey | ZYWUDDGKZMZWAP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|