C11H18N8O — CID 80918881
4-hydrazinyl-N-(3-methoxypropyl)-N-methyl-6-pyrazol-1-yl-1,3,5-triazin-2-amine (PubChem CID 80918881) has the molecular formula C11H18N8O and a molecular weight of 278.32 g/mol. Its IUPAC name is 4-hydrazinyl-N-(3-methoxypropyl)-N-methyl-6-pyrazol-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-N-(3-methoxypropyl)-N-methyl-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80918881 |
| Molecular Formula | C11H18N8O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 4-hydrazinyl-N-(3-methoxypropyl)-N-methyl-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
| SMILES | COCCCN(C)c1nc(NN)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C11H18N8O/c1-18(6-4-8-20-2)10-14-9(17-12)15-11(16-10)19-7-3-5-13-19/h3,5,7H,4,6,8,12H2,1-2H3,(H,14,15,16,17) |
| InChIKey | FOIGFWNRSCMAAQ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 107.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|