C10H16N8O2 — CID 80911229
1-[(4-hydrazinyl-6-pyrazol-1-yl-1,3,5-triazin-2-yl)amino]-3-methoxypropan-2-ol (PubChem CID 80911229) has the molecular formula C10H16N8O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is 1-[(4-hydrazinyl-6-pyrazol-1-yl-1,3,5-triazin-2-yl)amino]-3-methoxypropan-2-ol.
| Compound Name | 1-[(4-hydrazinyl-6-pyrazol-1-yl-1,3,5-triazin-2-yl)amino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 80911229 |
| Molecular Formula | C10H16N8O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 1-[(4-hydrazinyl-6-pyrazol-1-yl-1,3,5-triazin-2-yl)amino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CNc1nc(NN)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C10H16N8O2/c1-20-6-7(19)5-12-8-14-9(17-11)16-10(15-8)18-4-2-3-13-18/h2-4,7,19H,5-6,11H2,1H3,(H2,12,14,15,16,17) |
| InChIKey | BQJMBWQPJPFIJZ-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|