C10H14N8O2 — CID 80898546
ethyl 2-[(4-hydrazinyl-6-pyrazol-1-yl-1,3,5-triazin-2-yl)amino]acetate (PubChem CID 80898546) has the molecular formula C10H14N8O2 and a molecular weight of 278.28 g/mol. Its IUPAC name is ethyl 2-[(4-hydrazinyl-6-pyrazol-1-yl-1,3,5-triazin-2-yl)amino]acetate.
| Compound Name | ethyl 2-[(4-hydrazinyl-6-pyrazol-1-yl-1,3,5-triazin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 80898546 |
| Molecular Formula | C10H14N8O2 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | ethyl 2-[(4-hydrazinyl-6-pyrazol-1-yl-1,3,5-triazin-2-yl)amino]acetate |
| SMILES | CCOC(=O)CNc1nc(NN)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C10H14N8O2/c1-2-20-7(19)6-12-8-14-9(17-11)16-10(15-8)18-5-3-4-13-18/h3-5H,2,6,11H2,1H3,(H2,12,14,15,16,17) |
| InChIKey | KWAVDTIFQMISPB-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 132.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|