C9H14N8O2S — CID 80898787
4-hydrazinyl-N-(2-methylsulfonylethyl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine (PubChem CID 80898787) has the molecular formula C9H14N8O2S and a molecular weight of 298.33 g/mol. Its IUPAC name is 4-hydrazinyl-N-(2-methylsulfonylethyl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-N-(2-methylsulfonylethyl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80898787 |
| Molecular Formula | C9H14N8O2S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 4-hydrazinyl-N-(2-methylsulfonylethyl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
| SMILES | CS(=O)(=O)CCNc1nc(NN)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C9H14N8O2S/c1-20(18,19)6-4-11-7-13-8(16-10)15-9(14-7)17-5-2-3-12-17/h2-3,5H,4,6,10H2,1H3,(H2,11,13,14,15,16) |
| InChIKey | IXXIVBMKQDHWJR-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 140.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|