C10H15N9O — CID 80894247
2-[(4-hydrazinyl-6-pyrazol-1-yl-1,3,5-triazin-2-yl)amino]-N,N-dimethylacetamide (PubChem CID 80894247) has the molecular formula C10H15N9O and a molecular weight of 277.29 g/mol. Its IUPAC name is 2-[(4-hydrazinyl-6-pyrazol-1-yl-1,3,5-triazin-2-yl)amino]-N,N-dimethylacetamide.
| Compound Name | 2-[(4-hydrazinyl-6-pyrazol-1-yl-1,3,5-triazin-2-yl)amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 80894247 |
| Molecular Formula | C10H15N9O |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2-[(4-hydrazinyl-6-pyrazol-1-yl-1,3,5-triazin-2-yl)amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNc1nc(NN)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C10H15N9O/c1-18(2)7(20)6-12-8-14-9(17-11)16-10(15-8)19-5-3-4-13-19/h3-5H,6,11H2,1-2H3,(H2,12,14,15,16,17) |
| InChIKey | ABYDHRWQWUNAFT-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 126.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|