C13H21N7O — CID 80809214
2-N-ethyl-6-imidazol-1-yl-4-N-(3-methoxypropyl)-4-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 80809214) has the molecular formula C13H21N7O and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-N-ethyl-6-imidazol-1-yl-4-N-(3-methoxypropyl)-4-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-ethyl-6-imidazol-1-yl-4-N-(3-methoxypropyl)-4-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80809214 |
| Molecular Formula | C13H21N7O |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-N-ethyl-6-imidazol-1-yl-4-N-(3-methoxypropyl)-4-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(N(C)CCCOC)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C13H21N7O/c1-4-15-11-16-12(19(2)7-5-9-21-3)18-13(17-11)20-8-6-14-10-20/h6,8,10H,4-5,7,9H2,1-3H3,(H,15,16,17,18) |
| InChIKey | CAEHUUSRZOVGLR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|