C10H7F6N5 — CID 114566111
N-methyl-4-(trifluoromethyl)-6-[4-(trifluoromethyl)pyrazol-1-yl]pyrimidin-2-amine (PubChem CID 114566111) has the molecular formula C10H7F6N5 and a molecular weight of 311.19 g/mol. Its IUPAC name is N-methyl-4-(trifluoromethyl)-6-[4-(trifluoromethyl)pyrazol-1-yl]pyrimidin-2-amine.
| Compound Name | N-methyl-4-(trifluoromethyl)-6-[4-(trifluoromethyl)pyrazol-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 114566111 |
| Molecular Formula | C10H7F6N5 |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | N-methyl-4-(trifluoromethyl)-6-[4-(trifluoromethyl)pyrazol-1-yl]pyrimidin-2-amine |
| SMILES | CNc1nc(-n2cc(C(F)(F)F)cn2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H7F6N5/c1-17-8-19-6(10(14,15)16)2-7(20-8)21-4-5(3-18-21)9(11,12)13/h2-4H,1H3,(H,17,19,20) |
| InChIKey | OKTLZZARPJDBBE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |