C9H9F3N6 — CID 114567659
[4-(4-methylpyrazol-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine (PubChem CID 114567659) has the molecular formula C9H9F3N6 and a molecular weight of 258.21 g/mol. Its IUPAC name is [4-(4-methylpyrazol-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(4-methylpyrazol-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 114567659 |
| Molecular Formula | C9H9F3N6 |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | [4-(4-methylpyrazol-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
| SMILES | Cc1cnn(-c2cc(C(F)(F)F)nc(NN)n2)c1 |
| InChI | InChI=1S/C9H9F3N6/c1-5-3-14-18(4-5)7-2-6(9(10,11)12)15-8(16-7)17-13/h2-4H,13H2,1H3,(H,15,16,17) |
| InChIKey | IVLPFGDHYLUYIH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|