C9H8F3N7O — CID 114567674
1-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]pyrazole-4-carboxamide (PubChem CID 114567674) has the molecular formula C9H8F3N7O and a molecular weight of 287.21 g/mol. Its IUPAC name is 1-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]pyrazole-4-carboxamide.
| Compound Name | 1-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 114567674 |
| Molecular Formula | C9H8F3N7O |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1-[2-hydrazinyl-6-(trifluoromethyl)pyrimidin-4-yl]pyrazole-4-carboxamide |
| SMILES | NNc1nc(-n2cc(C(N)=O)cn2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H8F3N7O/c10-9(11,12)5-1-6(17-8(16-5)18-14)19-3-4(2-15-19)7(13)20/h1-3H,14H2,(H2,13,20)(H,16,17,18) |
| InChIKey | URYSYFHKMWZNKN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|