C10H9F3N6O — CID 102721195
1-[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide (PubChem CID 102721195) has the molecular formula C10H9F3N6O and a molecular weight of 286.22 g/mol. Its IUPAC name is 1-[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide.
| Compound Name | 1-[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 102721195 |
| Molecular Formula | C10H9F3N6O |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1-[6-hydrazinyl-4-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide |
| SMILES | NNc1cc(C(F)(F)F)cc(-n2cc(C(N)=O)cn2)n1 |
| InChI | InChI=1S/C10H9F3N6O/c11-10(12,13)6-1-7(18-15)17-8(2-6)19-4-5(3-16-19)9(14)20/h1-4H,15H2,(H2,14,20)(H,17,18) |
| InChIKey | UDIXISNEBOCASW-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|