C17H12F4N4O — CID 156852738
1-[2-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-pyridinyl]pyrazole-4-carboxamide (PubChem CID 156852738) has the molecular formula C17H12F4N4O and a molecular weight of 364.30 g/mol. Its IUPAC name is 1-[2-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-pyridinyl]pyrazole-4-carboxamide.
| Compound Name | 1-[2-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-pyridinyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 156852738 |
| Molecular Formula | C17H12F4N4O |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 1-[2-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-4-pyridinyl]pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cnn(-c2ccnc(Cc3cc(F)cc(C(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C17H12F4N4O/c18-13-4-10(3-12(6-13)17(19,20)21)5-14-7-15(1-2-23-14)25-9-11(8-24-25)16(22)26/h1-4,6-9H,5H2,(H2,22,26) |
| InChIKey | LIWYXCDJEGOSBA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |