C13H8ClF4N — CID 66827174
5-chloro-2-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]pyridine (PubChem CID 66827174) has the molecular formula C13H8ClF4N and a molecular weight of 289.66 g/mol. Its IUPAC name is 5-chloro-2-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]pyridine.
| Compound Name | 5-chloro-2-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]pyridine |
|---|---|
| PubChem CID | 66827174 |
| Molecular Formula | C13H8ClF4N |
| Molecular Weight | 289.66 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 5-chloro-2-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]pyridine |
| SMILES | Fc1cc(Cc2ccc(Cl)cn2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H8ClF4N/c14-10-1-2-12(19-7-10)5-8-3-9(13(16,17)18)6-11(15)4-8/h1-4,6-7H,5H2 |
| InChIKey | FRMPSSVZOHFKNQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |