C22H19ClF4N2O — CID 143474316
1-[[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]amino]ethanol (PubChem CID 143474316) has the molecular formula C22H19ClF4N2O and a molecular weight of 438.85 g/mol. Its IUPAC name is 1-[[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]amino]ethanol.
| Compound Name | 1-[[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]amino]ethanol |
|---|---|
| PubChem CID | 143474316 |
| Molecular Formula | C22H19ClF4N2O |
| Molecular Weight | 438.85 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 1-[[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]amino]ethanol |
| SMILES | CC(O)N[C@](Cc1ccccc1)(c1cc(F)cc(C(F)(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C22H19ClF4N2O/c1-14(30)29-21(12-15-5-3-2-4-6-15,20-8-7-18(23)13-28-20)16-9-17(22(25,26)27)11-19(24)10-16/h2-11,13-14,29-30H,12H2,1H3/t14?,21-/m1/s1 |
| InChIKey | FRRAIYAKKFKTES-OKKPIIHCSA-N |
| XLogP | 5.31 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.85 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|