C24H21ClF4N2O3 — CID 58920721
2-methoxyethyl N-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]carbamate (PubChem CID 58920721) has the molecular formula C24H21ClF4N2O3 and a molecular weight of 496.89 g/mol. Its IUPAC name is 2-methoxyethyl N-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]carbamate.
| Compound Name | 2-methoxyethyl N-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 58920721 |
| Molecular Formula | C24H21ClF4N2O3 |
| Molecular Weight | 496.89 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 2-methoxyethyl N-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]carbamate |
| SMILES | COCCOC(=O)N[C@@](Cc1ccccc1)(c1cc(F)cc(C(F)(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C24H21ClF4N2O3/c1-33-9-10-34-22(32)31-23(14-16-5-3-2-4-6-16,21-8-7-19(25)15-30-21)17-11-18(24(27,28)29)13-20(26)12-17/h2-8,11-13,15H,9-10,14H2,1H3,(H,31,32)/t23-/m0/s1 |
| InChIKey | FBXUQXKAQXQFMD-QHCPKHFHSA-N |
| XLogP | 5.75 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.89 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|