C8H8FN7O — CID 80902996
1-(5-fluoro-2-hydrazinylpyrimidin-4-yl)pyrazole-4-carboxamide (PubChem CID 80902996) has the molecular formula C8H8FN7O and a molecular weight of 237.20 g/mol. Its IUPAC name is 1-(5-fluoro-2-hydrazinylpyrimidin-4-yl)pyrazole-4-carboxamide.
| Compound Name | 1-(5-fluoro-2-hydrazinylpyrimidin-4-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 80902996 |
| Molecular Formula | C8H8FN7O |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 1-(5-fluoro-2-hydrazinylpyrimidin-4-yl)pyrazole-4-carboxamide |
| SMILES | NNc1ncc(F)c(-n2cc(C(N)=O)cn2)n1 |
| InChI | InChI=1S/C8H8FN7O/c9-5-2-12-8(15-11)14-7(5)16-3-4(1-13-16)6(10)17/h1-3H,11H2,(H2,10,17)(H,12,14,15) |
| InChIKey | UTVSYNPUGPXDGK-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|