C11H9ClF3N3 — CID 113378886
4-(chloromethyl)-2-methyl-6-[4-(trifluoromethyl)pyrazol-1-yl]pyridine (PubChem CID 113378886) has the molecular formula C11H9ClF3N3 and a molecular weight of 275.66 g/mol. Its IUPAC name is 4-(chloromethyl)-2-methyl-6-[4-(trifluoromethyl)pyrazol-1-yl]pyridine.
| Compound Name | 4-(chloromethyl)-2-methyl-6-[4-(trifluoromethyl)pyrazol-1-yl]pyridine |
|---|---|
| PubChem CID | 113378886 |
| Molecular Formula | C11H9ClF3N3 |
| Molecular Weight | 275.66 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 4-(chloromethyl)-2-methyl-6-[4-(trifluoromethyl)pyrazol-1-yl]pyridine |
| SMILES | Cc1cc(CCl)cc(-n2cc(C(F)(F)F)cn2)n1 |
| InChI | InChI=1S/C11H9ClF3N3/c1-7-2-8(4-12)3-10(17-7)18-6-9(5-16-18)11(13,14)15/h2-3,5-6H,4H2,1H3 |
| InChIKey | XBWWOZJBHMSZIV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.66 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|