C10H8F3N5S — CID 107548328
6-methyl-2-[4-(trifluoromethyl)pyrazol-1-yl]pyrimidine-4-carbothioamide (PubChem CID 107548328) has the molecular formula C10H8F3N5S and a molecular weight of 287.27 g/mol. Its IUPAC name is 6-methyl-2-[4-(trifluoromethyl)pyrazol-1-yl]pyrimidine-4-carbothioamide.
| Compound Name | 6-methyl-2-[4-(trifluoromethyl)pyrazol-1-yl]pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107548328 |
| Molecular Formula | C10H8F3N5S |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 6-methyl-2-[4-(trifluoromethyl)pyrazol-1-yl]pyrimidine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)nc(-n2cc(C(F)(F)F)cn2)n1 |
| InChI | InChI=1S/C10H8F3N5S/c1-5-2-7(8(14)19)17-9(16-5)18-4-6(3-15-18)10(11,12)13/h2-4H,1H3,(H2,14,19) |
| InChIKey | GJVHQQPEFNGEAG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|