C13H19N5OS — CID 107547072
2-(4-acetyl-1,4-diazepan-1-yl)-6-methylpyrimidine-4-carbothioamide (PubChem CID 107547072) has the molecular formula C13H19N5OS and a molecular weight of 293.40 g/mol. Its IUPAC name is 2-(4-acetyl-1,4-diazepan-1-yl)-6-methylpyrimidine-4-carbothioamide.
| Compound Name | 2-(4-acetyl-1,4-diazepan-1-yl)-6-methylpyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107547072 |
| Molecular Formula | C13H19N5OS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-(4-acetyl-1,4-diazepan-1-yl)-6-methylpyrimidine-4-carbothioamide |
| SMILES | CC(=O)N1CCCN(c2nc(C)cc(C(N)=S)n2)CC1 |
| InChI | InChI=1S/C13H19N5OS/c1-9-8-11(12(14)20)16-13(15-9)18-5-3-4-17(6-7-18)10(2)19/h8H,3-7H2,1-2H3,(H2,14,20) |
| InChIKey | UHIHHERLUWJEGF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|