C12H21N7O2 — CID 83104525
4-(2-amino-6-hydrazinylpyrimidin-4-yl)-N-propylmorpholine-3-carboxamide (PubChem CID 83104525) has the molecular formula C12H21N7O2 and a molecular weight of 295.35 g/mol. Its IUPAC name is 4-(2-amino-6-hydrazinylpyrimidin-4-yl)-N-propylmorpholine-3-carboxamide.
| Compound Name | 4-(2-amino-6-hydrazinylpyrimidin-4-yl)-N-propylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83104525 |
| Molecular Formula | C12H21N7O2 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 4-(2-amino-6-hydrazinylpyrimidin-4-yl)-N-propylmorpholine-3-carboxamide |
| SMILES | CCCNC(=O)C1COCCN1c1cc(NN)nc(N)n1 |
| InChI | InChI=1S/C12H21N7O2/c1-2-3-15-11(20)8-7-21-5-4-19(8)10-6-9(18-14)16-12(13)17-10/h6,8H,2-5,7,14H2,1H3,(H,15,20)(H3,13,16,17,18) |
| InChIKey | MGUAGHSWZYZEHD-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|