C14H21N3O2 — CID 129446161
(4aR,8aS)-4-(6-ethoxypyrazin-2-yl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine (PubChem CID 129446161) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is (4aR,8aS)-4-(6-ethoxypyrazin-2-yl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine.
| Compound Name | (4aR,8aS)-4-(6-ethoxypyrazin-2-yl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 129446161 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | (4aR,8aS)-4-(6-ethoxypyrazin-2-yl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
| SMILES | CCOc1cncc(N2CCO[C@H]3CCCC[C@H]32)n1 |
| InChI | InChI=1S/C14H21N3O2/c1-2-18-14-10-15-9-13(16-14)17-7-8-19-12-6-4-3-5-11(12)17/h9-12H,2-8H2,1H3/t11-,12+/m1/s1 |
| InChIKey | NNVQSMLEUHOZBG-NEPJUHHUSA-N |
| XLogP | 2.02 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |