C10H18N4O — CID 82236215
2-[1-(5-amino-1H-pyrazol-4-yl)piperidin-2-yl]ethanol (PubChem CID 82236215) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-[1-(5-amino-1H-pyrazol-4-yl)piperidin-2-yl]ethanol.
| Compound Name | 2-[1-(5-amino-1H-pyrazol-4-yl)piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 82236215 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 2-[1-(5-amino-1H-pyrazol-4-yl)piperidin-2-yl]ethanol |
| SMILES | Nc1[nH]ncc1N1CCCCC1CCO |
| InChI | InChI=1S/C10H18N4O/c11-10-9(7-12-13-10)14-5-2-1-3-8(14)4-6-15/h7-8,15H,1-6H2,(H3,11,12,13) |
| InChIKey | FXYQYAUNKLIOIH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 78.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |