C15H24N2O3 — CID 83001586
2-[1-(2-amino-4,5-dimethoxyphenyl)piperidin-2-yl]ethanol (PubChem CID 83001586) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-[1-(2-amino-4,5-dimethoxyphenyl)piperidin-2-yl]ethanol.
| Compound Name | 2-[1-(2-amino-4,5-dimethoxyphenyl)piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 83001586 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-[1-(2-amino-4,5-dimethoxyphenyl)piperidin-2-yl]ethanol |
| SMILES | COc1cc(N)c(N2CCCCC2CCO)cc1OC |
| InChI | InChI=1S/C15H24N2O3/c1-19-14-9-12(16)13(10-15(14)20-2)17-7-4-3-5-11(17)6-8-18/h9-11,18H,3-8,16H2,1-2H3 |
| InChIKey | IUSGNXHDCSXYLE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|