C14H22N2O — CID 82389615
2-[1-(2-methoxyphenyl)piperidin-2-yl]ethanamine (PubChem CID 82389615) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-[1-(2-methoxyphenyl)piperidin-2-yl]ethanamine.
| Compound Name | 2-[1-(2-methoxyphenyl)piperidin-2-yl]ethanamine |
|---|---|
| PubChem CID | 82389615 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 2-[1-(2-methoxyphenyl)piperidin-2-yl]ethanamine |
| SMILES | COc1ccccc1N1CCCCC1CCN |
| InChI | InChI=1S/C14H22N2O/c1-17-14-8-3-2-7-13(14)16-11-5-4-6-12(16)9-10-15/h2-3,7-8,12H,4-6,9-11,15H2,1H3 |
| InChIKey | KBXZBVMHRGACIL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |