C13H21N3OS2 — CID 103364571
2-(3-amino-4-methylsulfanyl-1,2-thiazol-5-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 103364571) has the molecular formula C13H21N3OS2 and a molecular weight of 299.47 g/mol. Its IUPAC name is 2-(3-amino-4-methylsulfanyl-1,2-thiazol-5-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-(3-amino-4-methylsulfanyl-1,2-thiazol-5-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 103364571 |
| Molecular Formula | C13H21N3OS2 |
| Molecular Weight | 299.47 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-(3-amino-4-methylsulfanyl-1,2-thiazol-5-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | CSc1c(N)nsc1N1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C13H21N3OS2/c1-18-10-11(14)15-19-12(10)16-7-6-13(17)5-3-2-4-9(13)8-16/h9,17H,2-8H2,1H3,(H2,14,15) |
| InChIKey | LTVJBPRTYMJFAG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |