C13H19ClN4O — CID 81115050
2-(2-amino-6-chloropyrimidin-4-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81115050) has the molecular formula C13H19ClN4O and a molecular weight of 282.77 g/mol. Its IUPAC name is 2-(2-amino-6-chloropyrimidin-4-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-(2-amino-6-chloropyrimidin-4-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81115050 |
| Molecular Formula | C13H19ClN4O |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-(2-amino-6-chloropyrimidin-4-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | Nc1nc(Cl)cc(N2CCC3(O)CCCCC3C2)n1 |
| InChI | InChI=1S/C13H19ClN4O/c14-10-7-11(17-12(15)16-10)18-6-5-13(19)4-2-1-3-9(13)8-18/h7,9,19H,1-6,8H2,(H2,15,16,17) |
| InChIKey | ICGVKPOPYMQFIQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |