C16H22ClN3O — CID 81108646
2-(6-chloro-2-cyclopropylpyrimidin-4-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81108646) has the molecular formula C16H22ClN3O and a molecular weight of 307.83 g/mol. Its IUPAC name is 2-(6-chloro-2-cyclopropylpyrimidin-4-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-(6-chloro-2-cyclopropylpyrimidin-4-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81108646 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.83 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-(6-chloro-2-cyclopropylpyrimidin-4-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | OC12CCCCC1CN(c1cc(Cl)nc(C3CC3)n1)CC2 |
| InChI | InChI=1S/C16H22ClN3O/c17-13-9-14(19-15(18-13)11-4-5-11)20-8-7-16(21)6-2-1-3-12(16)10-20/h9,11-12,21H,1-8,10H2 |
| InChIKey | QRQXOZROINLEQA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.83 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |