C12H16ClN3O — CID 80954082
[1-(6-chloro-2-cyclopropylpyrimidin-4-yl)pyrrolidin-2-yl]methanol (PubChem CID 80954082) has the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. Its IUPAC name is [1-(6-chloro-2-cyclopropylpyrimidin-4-yl)pyrrolidin-2-yl]methanol.
| Compound Name | [1-(6-chloro-2-cyclopropylpyrimidin-4-yl)pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 80954082 |
| Molecular Formula | C12H16ClN3O |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | [1-(6-chloro-2-cyclopropylpyrimidin-4-yl)pyrrolidin-2-yl]methanol |
| SMILES | OCC1CCCN1c1cc(Cl)nc(C2CC2)n1 |
| InChI | InChI=1S/C12H16ClN3O/c13-10-6-11(15-12(14-10)8-3-4-8)16-5-1-2-9(16)7-17/h6,8-9,17H,1-5,7H2 |
| InChIKey | ADPXRBMYZAGVBC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |