C16H24N4O — CID 114769124
2-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-6-methylpyridine-4-carboximidamide (PubChem CID 114769124) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-6-methylpyridine-4-carboximidamide.
| Compound Name | 2-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-6-methylpyridine-4-carboximidamide |
|---|---|
| PubChem CID | 114769124 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 2-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-6-methylpyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)nc(N2CCC3(O)CCCCC3C2)c1 |
| InChI | InChI=1S/C16H24N4O/c1-11-8-12(15(17)18)9-14(19-11)20-7-6-16(21)5-3-2-4-13(16)10-20/h8-9,13,21H,2-7,10H2,1H3,(H3,17,18) |
| InChIKey | HJFLUIWRAIRCMA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|