C11H17ClN4S — CID 133395200
4-chloro-6-(3-methylsulfanylazepan-1-yl)pyrimidin-2-amine (PubChem CID 133395200) has the molecular formula C11H17ClN4S and a molecular weight of 272.81 g/mol. Its IUPAC name is 4-chloro-6-(3-methylsulfanylazepan-1-yl)pyrimidin-2-amine.
| Compound Name | 4-chloro-6-(3-methylsulfanylazepan-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 133395200 |
| Molecular Formula | C11H17ClN4S |
| Molecular Weight | 272.81 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 4-chloro-6-(3-methylsulfanylazepan-1-yl)pyrimidin-2-amine |
| SMILES | CSC1CCCCN(c2cc(Cl)nc(N)n2)C1 |
| InChI | InChI=1S/C11H17ClN4S/c1-17-8-4-2-3-5-16(7-8)10-6-9(12)14-11(13)15-10/h6,8H,2-5,7H2,1H3,(H2,13,14,15) |
| InChIKey | AFWPUXJJKZAVSW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.81 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |